About 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole
1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole (PubChem CID 24982167) has the molecular formula C18H14F3N3O
and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole |
| PubChem CID | 24982167 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole |
| SMILES | COc1ccc(C2=NCCn3nc4cc(C(F)(F)F)ccc4c32)cc1 |
| InChI | InChI=1S/C18H14F3N3O/c1-25-13-5-2-11(3-6-13)16-17-14-7-4-12(18(19,20)21)10-15(14)23-24(17)9-8-22-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | HCRIDWVZPBFJOV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole?
The IUPAC name of 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole (CID 24982167) is 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole.
What is the SMILES notation for 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole?
The canonical SMILES for 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole is COc1ccc(C2=NCCn3nc4cc(C(F)(F)F)ccc4c32)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole?
The InChIKey is HCRIDWVZPBFJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N3O/c1-25-13-5-2-11(3-6-13)16-17-14-7-4-12(18(19,20)21)10-15(14)23-24(17)9-8-22-16/h2-7,10H,8-9H2,1H3.
What are the key properties of 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole?
1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole has a molecular weight of 345.32 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazole is sourced from PubChem (CID 24982167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).