C17H12N2O4 — CID 24982172
(4-methoxy-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-3-yl) acetate (PubChem CID 24982172) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is (4-methoxy-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-3-yl) acetate.
| Compound Name | (4-methoxy-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-3-yl) acetate |
|---|---|
| PubChem CID | 24982172 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (4-methoxy-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-3-yl) acetate |
| SMILES | COc1c(OC(C)=O)c(=O)n2c3ccccc3c3ccnc1c32 |
| InChI | InChI=1S/C17H12N2O4/c1-9(20)23-16-15(22-2)13-14-11(7-8-18-13)10-5-3-4-6-12(10)19(14)17(16)21/h3-8H,1-2H3 |
| InChIKey | YYGWINQHPKCLEF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |