About 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium
1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium (PubChem CID 24982192) has the molecular formula C17H14N4O3
and a molecular weight of 322.32 g/mol. Its IUPAC name is 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium |
| PubChem CID | 24982192 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium |
| SMILES | Cc1ccc(C2=NCCn3c2c2ccc([N+](=O)[O-])cc2[n+]3[O-])cc1 |
| InChI | InChI=1S/C17H14N4O3/c1-11-2-4-12(5-3-11)16-17-14-7-6-13(21(23)24)10-15(14)20(22)19(17)9-8-18-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | QMAWECFNTYSTQT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium?
The IUPAC name of 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium (CID 24982192) is 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium.
What is the SMILES notation for 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium?
The canonical SMILES for 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium is Cc1ccc(C2=NCCn3c2c2ccc([N+](=O)[O-])cc2[n+]3[O-])cc1.
What is the InChIKey of 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium?
The InChIKey is QMAWECFNTYSTQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O3/c1-11-2-4-12(5-3-11)16-17-14-7-6-13(21(23)24)10-15(14)20(22)19(17)9-8-18-16/h2-7,10H,8-9H2,1H3.
What are the key properties of 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium?
1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium has a molecular weight of 322.32 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium is sourced from PubChem (CID 24982192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).