About 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole
1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole (PubChem CID 24982222) has the molecular formula C16H12ClN3
and a molecular weight of 281.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole |
| PubChem CID | 24982222 |
| Molecular Formula | C16H12ClN3 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole |
| SMILES | Clc1ccc(C2=NCCn3nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C16H12ClN3/c17-12-7-5-11(6-8-12)15-16-13-3-1-2-4-14(13)19-20(16)10-9-18-15/h1-8H,9-10H2 |
| InChIKey | ANIQJLPBFDQHRL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole?
The IUPAC name of 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole (CID 24982222) is 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole.
What is the SMILES notation for 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole?
The canonical SMILES for 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole is Clc1ccc(C2=NCCn3nc4ccccc4c32)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole?
The InChIKey is ANIQJLPBFDQHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN3/c17-12-7-5-11(6-8-12)15-16-13-3-1-2-4-14(13)19-20(16)10-9-18-15/h1-8H,9-10H2.
What are the key properties of 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole?
1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole has a molecular weight of 281.75 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3,4-dihydropyrazino[1,2-b]indazole is sourced from PubChem (CID 24982222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).