C20H19F3N4O6 — CID 24982223
3-[3-(4-methylbenzoyl)-6-nitro-1-oxidoindazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate (PubChem CID 24982223) has the molecular formula C20H19F3N4O6 and a molecular weight of 468.39 g/mol. Its IUPAC name is 3-[3-(4-methylbenzoyl)-6-nitro-1-oxidoindazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate.
| Compound Name | 3-[3-(4-methylbenzoyl)-6-nitro-1-oxidoindazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 24982223 |
| Molecular Formula | C20H19F3N4O6 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-[3-(4-methylbenzoyl)-6-nitro-1-oxidoindazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)c2c3ccc([N+](=O)[O-])cc3[n+]([O-])n2CCC[NH3+])cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H18N4O4.C2HF3O2/c1-12-3-5-13(6-4-12)18(23)17-15-8-7-14(22(25)26)11-16(15)21(24)20(17)10-2-9-19;3-2(4,5)1(6)7/h3-8,11H,2,9-10,19H2,1H3;(H,6,7) |
| InChIKey | WZBNRSBGBXWVGT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|