C18H13F3N6O4 — CID 24982270
N-methyl-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 24982270) has the molecular formula C18H13F3N6O4 and a molecular weight of 434.33 g/mol. Its IUPAC name is N-methyl-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-methyl-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 24982270 |
| Molecular Formula | C18H13F3N6O4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-methyl-3-nitro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13F3N6O4/c1-25(7-15(28)24-12-4-3-11(19)16(20)17(12)21)18(29)10-2-5-13(14(6-10)27(30)31)26-9-22-8-23-26/h2-6,8-9H,7H2,1H3,(H,24,28) |
| InChIKey | LAZUHZMRYPXDDU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|