About 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide
1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide (PubChem CID 24982320) has the molecular formula C16H19N3O5
and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide.
Molecular Properties
| Compound Name | 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide |
| PubChem CID | 24982320 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccn2C)cc(OC)c1OC |
| InChI | InChI=1S/C16H19N3O5/c1-19-7-5-6-11(19)16(21)18-17-15(20)10-8-12(22-2)14(24-4)13(9-10)23-3/h5-9H,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | MRWFMOJNBUGUQQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide?
The IUPAC name of 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide (CID 24982320) is 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide.
What is the SMILES notation for 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide?
The canonical SMILES for 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide is COc1cc(C(=O)NNC(=O)c2cccn2C)cc(OC)c1OC.
What is the InChIKey of 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide?
The InChIKey is MRWFMOJNBUGUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O5/c1-19-7-5-6-11(19)16(21)18-17-15(20)10-8-12(22-2)14(24-4)13(9-10)23-3/h5-9H,1-4H3,(H,17,20)(H,18,21).
What are the key properties of 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide?
1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide has a molecular weight of 333.34 g/mol, XLogP of 1.13, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N'-(3,4,5-trimethoxybenzoyl)pyrrole-2-carbohydrazide is sourced from PubChem (CID 24982320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).