C18H19N5O4S — CID 24982521
7a-methyl-N'-(3-methyl-4-oxophthalazine-1-carbonyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide (PubChem CID 24982521) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is 7a-methyl-N'-(3-methyl-4-oxophthalazine-1-carbonyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide.
| Compound Name | 7a-methyl-N'-(3-methyl-4-oxophthalazine-1-carbonyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide |
|---|---|
| PubChem CID | 24982521 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 7a-methyl-N'-(3-methyl-4-oxophthalazine-1-carbonyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)C2CSC3(C)CCC(=O)N23)c2ccccc2c1=O |
| InChI | InChI=1S/C18H19N5O4S/c1-18-8-7-13(24)23(18)12(9-28-18)15(25)19-20-16(26)14-10-5-3-4-6-11(10)17(27)22(2)21-14/h3-6,12H,7-9H2,1-2H3,(H,19,25)(H,20,26) |
| InChIKey | PJVKGFXIQQHIFP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|