C22H21N5O5S2 — CID 24982574
2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 24982574) has the molecular formula C22H21N5O5S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24982574 |
| Molecular Formula | C22H21N5O5S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccc(S(=O)(=O)Nc4nccs4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H21N5O5S2/c1-14-3-5-15(6-4-14)22(2)19(29)27(21(30)25-22)13-18(28)24-16-7-9-17(10-8-16)34(31,32)26-20-23-11-12-33-20/h3-12H,13H2,1-2H3,(H,23,26)(H,24,28)(H,25,30) |
| InChIKey | NFMXAYLPHPSVHK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|