About N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide (PubChem CID 24982705) has the molecular formula C18H17ClN4O2
and a molecular weight of 356.81 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide.
Molecular Properties
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide |
| PubChem CID | 24982705 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C18H17ClN4O2/c1-2-17(25-14-6-4-3-5-7-14)18(24)22-15-10-13(19)8-9-16(15)23-12-20-11-21-23/h3-12,17H,2H2,1H3,(H,22,24) |
| InChIKey | QPDKOSFLADWBIG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide?
The IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide (CID 24982705) is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide.
What is the SMILES notation for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide?
The canonical SMILES for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide is CCC(Oc1ccccc1)C(=O)Nc1cc(Cl)ccc1-n1cncn1.
What is the InChIKey of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide?
The InChIKey is QPDKOSFLADWBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4O2/c1-2-17(25-14-6-4-3-5-7-14)18(24)22-15-10-13(19)8-9-16(15)23-12-20-11-21-23/h3-12,17H,2H2,1H3,(H,22,24).
What are the key properties of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide?
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide has a molecular weight of 356.81 g/mol, XLogP of 3.72, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-phenoxybutanamide is sourced from PubChem (CID 24982705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).