C27H28Cl2N2O5 — CID 24982712
methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate (PubChem CID 24982712) has the molecular formula C27H28Cl2N2O5 and a molecular weight of 531.44 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate.
| Compound Name | methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
|---|---|
| PubChem CID | 24982712 |
| Molecular Formula | C27H28Cl2N2O5 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)-3-methoxyphenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](c3ccc(-c4ccc(Cl)c(Cl)c4)c(OC)c3)N3CCCC[C@@]3(C(=O)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C27H28Cl2N2O5/c1-4-30-24(32)21-22(25(30)33)27(26(34)36-3)11-5-6-12-31(27)23(21)16-7-9-17(20(14-16)35-2)15-8-10-18(28)19(29)13-15/h7-10,13-14,21-23H,4-6,11-12H2,1-3H3/t21-,22-,23+,27-/m0/s1 |
| InChIKey | JJEIFRDWZHBNQT-TZKYFUQOSA-N |
| XLogP | 4.74 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|