C19H28O6 — CID 24982849
(2S,3aR,6R,7aR)-2-[(2R,5R)-5-hydroxyhexan-2-yl]oxy-5-methyl-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol (PubChem CID 24982849) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S,3aR,6R,7aR)-2-[(2R,5R)-5-hydroxyhexan-2-yl]oxy-5-methyl-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol.
| Compound Name | (2S,3aR,6R,7aR)-2-[(2R,5R)-5-hydroxyhexan-2-yl]oxy-5-methyl-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol |
|---|---|
| PubChem CID | 24982849 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2S,3aR,6R,7aR)-2-[(2R,5R)-5-hydroxyhexan-2-yl]oxy-5-methyl-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol |
| SMILES | CC1O[C@@H]2O[C@](O[C@H](C)CC[C@@H](C)O)(c3ccccc3)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C19H28O6/c1-12(20)9-10-13(2)23-19(15-7-5-4-6-8-15)24-17-11-16(21)14(3)22-18(17)25-19/h4-8,12-14,16-18,20-21H,9-11H2,1-3H3/t12-,13-,14?,16-,17-,18-,19+/m1/s1 |
| InChIKey | WWMQSNWZYMIALE-UZFWHCTISA-N |
| XLogP | 2.27 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |