C21H28N4O7 — CID 24982871
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 24982871) has the molecular formula C21H28N4O7 and a molecular weight of 448.48 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 24982871 |
| Molecular Formula | C21H28N4O7 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)cc1OCC |
| InChI | InChI=1S/C21H28N4O7/c1-5-30-17-8-7-16(11-18(17)31-6-2)9-10-22-19(26)13-32-20(27)12-24-15(4)21(25(28)29)14(3)23-24/h7-8,11H,5-6,9-10,12-13H2,1-4H3,(H,22,26) |
| InChIKey | KHBRVRYFUPHTLL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|