About [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate
[4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 24983156) has the molecular formula C18H16N2O5S
and a molecular weight of 372.40 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate.
Molecular Properties
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate |
| PubChem CID | 24983156 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Oc2ccc(-c3nnco3)cc2)cc1 |
| InChI | InChI=1S/C18H16N2O5S/c1-13-2-8-16(9-3-13)26(22,23)11-10-17(21)25-15-6-4-14(5-7-15)18-20-19-12-24-18/h2-9,12H,10-11H2,1H3 |
| InChIKey | AIHFYCKPALJBKE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate?
The IUPAC name of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate (CID 24983156) is [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate.
What is the SMILES notation for [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate?
The canonical SMILES for [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate is Cc1ccc(S(=O)(=O)CCC(=O)Oc2ccc(-c3nnco3)cc2)cc1.
What is the InChIKey of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate?
The InChIKey is AIHFYCKPALJBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5S/c1-13-2-8-16(9-3-13)26(22,23)11-10-17(21)25-15-6-4-14(5-7-15)18-20-19-12-24-18/h2-9,12H,10-11H2,1H3.
What are the key properties of [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate?
[4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate has a molecular weight of 372.40 g/mol, XLogP of 2.81, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3,4-oxadiazol-2-yl)phenyl] 3-(4-methylphenyl)sulfonylpropanoate is sourced from PubChem (CID 24983156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).