C34H42N4O7S2 — CID 24983741
(1S,4R,6S,7Z,14S,18R)-N-cyclopropylsulfonyl-14-[(2-methoxyacetyl)amino]-18-naphthalen-1-ylsulfanyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 24983741) has the molecular formula C34H42N4O7S2 and a molecular weight of 682.87 g/mol. Its IUPAC name is (1S,4R,6S,7Z,14S,18R)-N-cyclopropylsulfonyl-14-[(2-methoxyacetyl)amino]-18-naphthalen-1-ylsulfanyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | (1S,4R,6S,7Z,14S,18R)-N-cyclopropylsulfonyl-14-[(2-methoxyacetyl)amino]-18-naphthalen-1-ylsulfanyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 24983741 |
| Molecular Formula | C34H42N4O7S2 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | (1S,4R,6S,7Z,14S,18R)-N-cyclopropylsulfonyl-14-[(2-methoxyacetyl)amino]-18-naphthalen-1-ylsulfanyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | COCC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2C[C@@H](Sc3cccc4ccccc34)CN2C1=O |
| InChI | InChI=1S/C34H42N4O7S2/c1-45-21-30(39)35-27-14-6-4-2-3-5-12-23-19-34(23,33(42)37-47(43,44)25-16-17-25)36-31(40)28-18-24(20-38(28)32(27)41)46-29-15-9-11-22-10-7-8-13-26(22)29/h5,7-13,15,23-25,27-28H,2-4,6,14,16-21H2,1H3,(H,35,39)(H,36,40)(H,37,42)/b12-5-/t23-,24-,27+,28+,34-/m1/s1 |
| InChIKey | WRTMWPCFDDLSHY-SGYZEDFXSA-N |
| XLogP | 3.04 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|