C31H27N3O5 — CID 24984100
2-[2-[[4-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]carbamoyl]phenyl]benzoic acid (PubChem CID 24984100) has the molecular formula C31H27N3O5 and a molecular weight of 521.57 g/mol. Its IUPAC name is 2-[2-[[4-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]carbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[[4-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 24984100 |
| Molecular Formula | C31H27N3O5 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[2-[[4-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]carbamoyl]phenyl]benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H27N3O5/c35-29(32-23-13-15-24(16-14-23)34-17-19-39-20-18-34)21-9-11-22(12-10-21)33-30(36)27-7-3-1-5-25(27)26-6-2-4-8-28(26)31(37)38/h1-16H,17-20H2,(H,32,35)(H,33,36)(H,37,38) |
| InChIKey | OYQDUMVGCXREIP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|