C24H26N4O3 — CID 24984211
[10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] cyclopropanecarboxylate (PubChem CID 24984211) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] cyclopropanecarboxylate.
| Compound Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 24984211 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] cyclopropanecarboxylate |
| SMILES | CCN(CC)CCNc1ccc2ncn3c4ccc(OC(=O)C5CC5)cc4c(=O)c1c23 |
| InChI | InChI=1S/C24H26N4O3/c1-3-27(4-2)12-11-25-18-8-9-19-22-21(18)23(29)17-13-16(31-24(30)15-5-6-15)7-10-20(17)28(22)14-26-19/h7-10,13-15,25H,3-6,11-12H2,1-2H3 |
| InChIKey | IUNMZFXGDPJWFF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|