C21H21F3N2O3 — CID 24984321
(12R)-4,5,10-trimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol (PubChem CID 24984321) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is (12R)-4,5,10-trimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol.
| Compound Name | (12R)-4,5,10-trimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol |
|---|---|
| PubChem CID | 24984321 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (12R)-4,5,10-trimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol |
| SMILES | Cc1nc2c3c(ccn2c1C)C(C)(OCC(F)(F)F)C(O)[C@@H](c1ccccc1)O3 |
| InChI | InChI=1S/C21H21F3N2O3/c1-12-13(2)26-10-9-15-17(19(26)25-12)29-16(14-7-5-4-6-8-14)18(27)20(15,3)28-11-21(22,23)24/h4-10,16,18,27H,11H2,1-3H3/t16-,18?,20?/m1/s1 |
| InChIKey | IROCWUFMABYEHP-PPDQVPDSSA-N |
| XLogP | 4.24 |
| TPSA | 55.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |