About 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol
1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol (PubChem CID 24984451) has the molecular formula C19H21N3O3S
and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol |
| PubChem CID | 24984451 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol |
| SMILES | CC(O)c1cc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C19H21N3O3S/c1-13(23)18-12-17-16(8-9-20-19(17)21-18)14-4-6-15(7-5-14)26(24,25)22-10-2-3-11-22/h4-9,12-13,23H,2-3,10-11H2,1H3,(H,20,21) |
| InChIKey | AHHLNCFGWRNJBQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol?
The IUPAC name of 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol (CID 24984451) is 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol.
What is the SMILES notation for 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol?
The canonical SMILES for 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol is CC(O)c1cc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)ccnc2[nH]1.
What is the InChIKey of 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol?
The InChIKey is AHHLNCFGWRNJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3S/c1-13(23)18-12-17-16(8-9-20-19(17)21-18)14-4-6-15(7-5-14)26(24,25)22-10-2-3-11-22/h4-9,12-13,23H,2-3,10-11H2,1H3,(H,20,21).
What are the key properties of 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol?
1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol has a molecular weight of 371.46 g/mol, XLogP of 3.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]ethanol is sourced from PubChem (CID 24984451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).