C20H16F3N3O2 — CID 24984709
[(3S)-3-[4-(2,4-difluorophenyl)-1,3-oxazol-2-yl]piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone (PubChem CID 24984709) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is [(3S)-3-[4-(2,4-difluorophenyl)-1,3-oxazol-2-yl]piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone.
| Compound Name | [(3S)-3-[4-(2,4-difluorophenyl)-1,3-oxazol-2-yl]piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 24984709 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [(3S)-3-[4-(2,4-difluorophenyl)-1,3-oxazol-2-yl]piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCC[C@H](c2nc(-c3ccc(F)cc3F)co2)C1 |
| InChI | InChI=1S/C20H16F3N3O2/c21-14-4-5-15(16(22)8-14)17-11-28-19(25-17)13-2-1-7-26(10-13)20(27)12-3-6-18(23)24-9-12/h3-6,8-9,11,13H,1-2,7,10H2/t13-/m0/s1 |
| InChIKey | GEXACRVYNAAIGU-ZDUSSCGKSA-N |
| XLogP | 4.17 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|