C29H44N2O8 — CID 24985161
[(4E,8S,9S,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16,19-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate (PubChem CID 24985161) has the molecular formula C29H44N2O8 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(4E,8S,9S,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16,19-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate.
| Compound Name | [(4E,8S,9S,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16,19-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 24985161 |
| Molecular Formula | C29H44N2O8 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | [(4E,8S,9S,10E,12S,13R,14S,16S,17R)-13,17,20-trihydroxy-8,14-dimethoxy-4,10,12,16,19-pentamethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate |
| SMILES | CO[C@H]1C[C@H](C)[C@@H](O)c2cc(cc(O)c2C)NC(=O)/C(C)=C/CC[C@H](OC)[C@@H](OC(N)=O)/C(C)=C/[C@H](C)[C@H]1O |
| InChI | InChI=1S/C29H44N2O8/c1-15-9-8-10-23(37-6)27(39-29(30)36)18(4)11-16(2)26(34)24(38-7)12-17(3)25(33)21-13-20(31-28(15)35)14-22(32)19(21)5/h9,11,13-14,16-17,23-27,32-34H,8,10,12H2,1-7H3,(H2,30,36)(H,31,35)/b15-9+,18-11+/t16-,17-,23-,24-,25+,26+,27-/m0/s1 |
| InChIKey | PHUJACLAWXGWFA-XWHVACSZSA-N |
| XLogP | 3.88 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|