C21H15F3N4OS — CID 2498553
2-[methyl-(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2498553) has the molecular formula C21H15F3N4OS and a molecular weight of 428.44 g/mol. Its IUPAC name is 2-[methyl-(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[methyl-(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2498553 |
| Molecular Formula | C21H15F3N4OS |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[methyl-(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)c1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C21H15F3N4OS/c1-28(10-17(29)27-15-8-7-14(22)18(23)19(15)24)20-13-9-16(12-5-3-2-4-6-12)30-21(13)26-11-25-20/h2-9,11H,10H2,1H3,(H,27,29) |
| InChIKey | XFXFYNLMINTBDX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|