C24H30N6O4S — CID 24985835
(1S,2S,3S,6R)-3-(2-hydroxyethoxy)-6-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclohex-4-ene-1,2-diol (PubChem CID 24985835) has the molecular formula C24H30N6O4S and a molecular weight of 498.61 g/mol. Its IUPAC name is (1S,2S,3S,6R)-3-(2-hydroxyethoxy)-6-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclohex-4-ene-1,2-diol.
| Compound Name | (1S,2S,3S,6R)-3-(2-hydroxyethoxy)-6-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 24985835 |
| Molecular Formula | C24H30N6O4S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (1S,2S,3S,6R)-3-(2-hydroxyethoxy)-6-[7-[[(1R,2S)-2-phenylcyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclohex-4-ene-1,2-diol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccccc2)c2nnn([C@@H]3C=C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H30N6O4S/c1-2-12-35-24-26-22(25-16-13-15(16)14-6-4-3-5-7-14)19-23(27-24)30(29-28-19)17-8-9-18(34-11-10-31)21(33)20(17)32/h3-9,15-18,20-21,31-33H,2,10-13H2,1H3,(H,25,26,27)/t15-,16+,17+,18-,20-,21+/m0/s1 |
| InChIKey | UBARFUMLZDHZHH-XUJOMZSTSA-N |
| XLogP | 1.90 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|