C23H23F3N2O3 — CID 24986146
(10S,11R,12R)-10-cyclopropyl-4,5-dimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol (PubChem CID 24986146) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is (10S,11R,12R)-10-cyclopropyl-4,5-dimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol.
| Compound Name | (10S,11R,12R)-10-cyclopropyl-4,5-dimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol |
|---|---|
| PubChem CID | 24986146 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (10S,11R,12R)-10-cyclopropyl-4,5-dimethyl-12-phenyl-10-(2,2,2-trifluoroethoxy)-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-ol |
| SMILES | Cc1nc2c3c(ccn2c1C)[C@@](OCC(F)(F)F)(C1CC1)[C@H](O)[C@@H](c1ccccc1)O3 |
| InChI | InChI=1S/C23H23F3N2O3/c1-13-14(2)28-11-10-17-19(21(28)27-13)31-18(15-6-4-3-5-7-15)20(29)23(17,16-8-9-16)30-12-22(24,25)26/h3-7,10-11,16,18,20,29H,8-9,12H2,1-2H3/t18-,20-,23+/m1/s1 |
| InChIKey | YFNUWQRDHSRFDR-XQFWAAQXSA-N |
| XLogP | 4.63 |
| TPSA | 55.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |