C23H31ClO4 — CID 24986179
[(3R,8R,9S,10R,13S,14S,17R)-17-acetyl-3-chloro-3-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 24986179) has the molecular formula C23H31ClO4 and a molecular weight of 406.95 g/mol. Its IUPAC name is [(3R,8R,9S,10R,13S,14S,17R)-17-acetyl-3-chloro-3-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3R,8R,9S,10R,13S,14S,17R)-17-acetyl-3-chloro-3-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 24986179 |
| Molecular Formula | C23H31ClO4 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(3R,8R,9S,10R,13S,14S,17R)-17-acetyl-3-chloro-3-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3C=CC4=C[C@](O)(Cl)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H31ClO4/c1-14(25)23(28-15(2)26)10-8-19-17-6-5-16-13-22(24,27)12-11-20(16,3)18(17)7-9-21(19,23)4/h5-6,13,17-19,27H,7-12H2,1-4H3/t17-,18+,19+,20+,21+,22+,23+/m1/s1 |
| InChIKey | UTWTXACNOXHNHI-KVWWBZGASA-N |
| XLogP | 4.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|