C22H19ClFNO6S — CID 24987050
6-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 24987050) has the molecular formula C22H19ClFNO6S and a molecular weight of 479.91 g/mol. Its IUPAC name is 6-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 24987050 |
| Molecular Formula | C22H19ClFNO6S |
| Molecular Weight | 479.91 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 6-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(c2ccc(Cl)c(Cc3ccc(-c4ccc(F)nc4)s3)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C22H19ClFNO6S/c23-14-4-1-10(20-18(27)17(26)19(28)21(31-20)22(29)30)7-12(14)8-13-3-5-15(32-13)11-2-6-16(24)25-9-11/h1-7,9,17-21,26-28H,8H2,(H,29,30) |
| InChIKey | PJTIEJPZXKHJPN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|