About (3-ethenylphenyl) hydrogen sulfate
(3-ethenylphenyl) hydrogen sulfate (PubChem CID 24987667) has the molecular formula C8H8O4S
and a molecular weight of 200.22 g/mol. Its IUPAC name is (3-ethenylphenyl) hydrogen sulfate.
Molecular Properties
| Compound Name | (3-ethenylphenyl) hydrogen sulfate |
| PubChem CID | 24987667 |
| Molecular Formula | C8H8O4S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | (3-ethenylphenyl) hydrogen sulfate |
| SMILES | C=Cc1cccc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H8O4S/c1-2-7-4-3-5-8(6-7)12-13(9,10)11/h2-6H,1H2,(H,9,10,11) |
| InChIKey | MTJWPWXISDJJOR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3-ethenylphenyl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethenylphenyl) hydrogen sulfate?
The IUPAC name of (3-ethenylphenyl) hydrogen sulfate (CID 24987667) is (3-ethenylphenyl) hydrogen sulfate.
What is the SMILES notation for (3-ethenylphenyl) hydrogen sulfate?
The canonical SMILES for (3-ethenylphenyl) hydrogen sulfate is C=Cc1cccc(OS(=O)(=O)O)c1.
What is the InChIKey of (3-ethenylphenyl) hydrogen sulfate?
The InChIKey is MTJWPWXISDJJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S/c1-2-7-4-3-5-8(6-7)12-13(9,10)11/h2-6H,1H2,(H,9,10,11).
What are the key properties of (3-ethenylphenyl) hydrogen sulfate?
(3-ethenylphenyl) hydrogen sulfate has a molecular weight of 200.22 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethenylphenyl) hydrogen sulfate is sourced from PubChem (CID 24987667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).