About 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide
6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide (PubChem CID 24988325) has the molecular formula C18H19N5O2
and a molecular weight of 337.38 g/mol. Its IUPAC name is 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide |
| PubChem CID | 24988325 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(-c2ccc3c(C(N)=O)c(NC(N)=O)[nH]c3c2)c(N)c1C |
| InChI | InChI=1S/C18H19N5O2/c1-8-3-5-11(15(19)9(8)2)10-4-6-12-13(7-10)22-17(23-18(21)25)14(12)16(20)24/h3-7,22H,19H2,1-2H3,(H2,20,24)(H3,21,23,25) |
| InChIKey | FGAIYANKYJZKGL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide?
The IUPAC name of 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide (CID 24988325) is 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide.
What is the SMILES notation for 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide?
The canonical SMILES for 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide is Cc1ccc(-c2ccc3c(C(N)=O)c(NC(N)=O)[nH]c3c2)c(N)c1C.
What is the InChIKey of 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide?
The InChIKey is FGAIYANKYJZKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O2/c1-8-3-5-11(15(19)9(8)2)10-4-6-12-13(7-10)22-17(23-18(21)25)14(12)16(20)24/h3-7,22H,19H2,1-2H3,(H2,20,24)(H3,21,23,25).
What are the key properties of 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide?
6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide has a molecular weight of 337.38 g/mol, XLogP of 2.62, 3 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-amino-3,4-dimethylphenyl)-2-(carbamoylamino)-1H-indole-3-carboxamide is sourced from PubChem (CID 24988325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).