C27H27ClN6O — CID 24988521
5-[8-[3-chloro-4-(4-ethylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]-2,3-dihydroisoindol-1-one (PubChem CID 24988521) has the molecular formula C27H27ClN6O and a molecular weight of 487.01 g/mol. Its IUPAC name is 5-[8-[3-chloro-4-(4-ethylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[8-[3-chloro-4-(4-ethylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 24988521 |
| Molecular Formula | C27H27ClN6O |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 5-[8-[3-chloro-4-(4-ethylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]-2,3-dihydroisoindol-1-one |
| SMILES | CCN1CCN(c2ccc(Nc3ccc(-c4ccc5c(c4)CNC5=O)n4ccnc34)cc2Cl)CC1 |
| InChI | InChI=1S/C27H27ClN6O/c1-2-32-11-13-33(14-12-32)25-7-4-20(16-22(25)28)31-23-6-8-24(34-10-9-29-26(23)34)18-3-5-21-19(15-18)17-30-27(21)35/h3-10,15-16,31H,2,11-14,17H2,1H3,(H,30,35) |
| InChIKey | DNHMZLYPVWLUHB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|