C20H22ClN5O — CID 24988747
N-[(4-chlorophenyl)methyl]-3-(4-methylpiperazin-1-yl)-1H-indazole-5-carboxamide (PubChem CID 24988747) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(4-methylpiperazin-1-yl)-1H-indazole-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(4-methylpiperazin-1-yl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 24988747 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(4-methylpiperazin-1-yl)-1H-indazole-5-carboxamide |
| SMILES | CN1CCN(c2n[nH]c3ccc(C(=O)NCc4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C20H22ClN5O/c1-25-8-10-26(11-9-25)19-17-12-15(4-7-18(17)23-24-19)20(27)22-13-14-2-5-16(21)6-3-14/h2-7,12H,8-11,13H2,1H3,(H,22,27)(H,23,24) |
| InChIKey | CFEPZQZOKGHZKE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |