C25H38O3 — CID 24988909
[(2E,7E,9E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trienyl] 2,2-dimethylpropanoate (PubChem CID 24988909) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is [(2E,7E,9E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,7E,9E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24988909 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | [(2E,7E,9E)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trienyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\C=C\C(C)CC/C=C(\C)COC(=O)C(C)(C)C)CCCc1ccoc1 |
| InChI | InChI=1S/C25H38O3/c1-20(12-8-14-22(3)18-28-24(26)25(4,5)6)10-7-11-21(2)13-9-15-23-16-17-27-19-23/h7,10-11,14,16-17,19-20H,8-9,12-13,15,18H2,1-6H3/b10-7+,21-11+,22-14+ |
| InChIKey | OFXRDWLPEZENLC-NFPUXSLBSA-N |
| XLogP | 7.06 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|