C12H17NO4 — CID 24988922
(4R,7R)-2-(1-hydroxy-2-methylpropan-2-yl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 24988922) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (4R,7R)-2-(1-hydroxy-2-methylpropan-2-yl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (4R,7R)-2-(1-hydroxy-2-methylpropan-2-yl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 24988922 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (4R,7R)-2-(1-hydroxy-2-methylpropan-2-yl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC(C)(CO)N1C(=O)C2C(C1=O)[C@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C12H17NO4/c1-12(2,5-14)13-10(15)8-6-3-4-7(17-6)9(8)11(13)16/h6-9,14H,3-5H2,1-2H3/t6-,7-,8?,9?/m1/s1 |
| InChIKey | BOPRYLNPYBAUQD-PZYMCFGQSA-N |
| XLogP | -0.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|