C20H12ClF3N4O5 — CID 24988935
3-[3-chloro-5-[5-[4-nitro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanoic acid (PubChem CID 24988935) has the molecular formula C20H12ClF3N4O5 and a molecular weight of 480.79 g/mol. Its IUPAC name is 3-[3-chloro-5-[5-[4-nitro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanoic acid.
| Compound Name | 3-[3-chloro-5-[5-[4-nitro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 24988935 |
| Molecular Formula | C20H12ClF3N4O5 |
| Molecular Weight | 480.79 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 3-[3-chloro-5-[5-[4-nitro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(Cl)c2cc(-c3noc(-c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)n3)ccc21 |
| InChI | InChI=1S/C20H12ClF3N4O5/c21-14-9-27(6-5-17(29)30)15-3-1-10(7-12(14)15)18-25-19(33-26-18)11-2-4-16(28(31)32)13(8-11)20(22,23)24/h1-4,7-9H,5-6H2,(H,29,30) |
| InChIKey | YOCISYLTMKQWMT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|