About 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one
7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one (PubChem CID 24989396) has the molecular formula C23H23NO3
and a molecular weight of 361.44 g/mol. Its IUPAC name is 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one.
Molecular Properties
| Compound Name | 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one |
| PubChem CID | 24989396 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one |
| SMILES | Cc1c(-c2ccccc2)c(=O)oc2cc(OC3C[C@H]4CC[C@H](C3)N4)ccc12 |
| InChI | InChI=1S/C23H23NO3/c1-14-20-10-9-18(26-19-11-16-7-8-17(12-19)24-16)13-21(20)27-23(25)22(14)15-5-3-2-4-6-15/h2-6,9-10,13,16-17,19,24H,7-8,11-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | PNOCBMSOXQHIPP-IAGOWNOFSA-N |
| XLogP | 4.43 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one?
The IUPAC name of 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one (CID 24989396) is 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one.
What is the SMILES notation for 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one?
The canonical SMILES for 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one is Cc1c(-c2ccccc2)c(=O)oc2cc(OC3C[C@H]4CC[C@H](C3)N4)ccc12.
What is the InChIKey of 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one?
The InChIKey is PNOCBMSOXQHIPP-IAGOWNOFSA-N. The full InChI is InChI=1S/C23H23NO3/c1-14-20-10-9-18(26-19-11-16-7-8-17(12-19)24-16)13-21(20)27-23(25)22(14)15-5-3-2-4-6-15/h2-6,9-10,13,16-17,19,24H,7-8,11-12H2,1H3/t16-,17-/m1/s1.
What are the key properties of 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one?
7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one has a molecular weight of 361.44 g/mol, XLogP of 4.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[(1R,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-4-methyl-3-phenylchromen-2-one is sourced from PubChem (CID 24989396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).