C25H38N4O4 — CID 24989778
4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-N-[(2R)-1-hydroxypropan-2-yl]-2-methylbenzamide (PubChem CID 24989778) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-N-[(2R)-1-hydroxypropan-2-yl]-2-methylbenzamide.
| Compound Name | 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-N-[(2R)-1-hydroxypropan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 24989778 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-N-[(2R)-1-hydroxypropan-2-yl]-2-methylbenzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3nc(C(C)(C)C)no3)CC2)ccc1C(=O)N[C@H](C)CO |
| InChI | InChI=1S/C25H38N4O4/c1-17-15-20(8-9-21(17)22(31)26-18(2)16-30)32-14-6-7-19-10-12-29(13-11-19)24-27-23(28-33-24)25(3,4)5/h8-9,15,18-19,30H,6-7,10-14,16H2,1-5H3,(H,26,31)/t18-/m1/s1 |
| InChIKey | RBSANYVNLXJCAK-GOSISDBHSA-N |
| XLogP | 3.86 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|