C25H29ClN4O — CID 24989831
6-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 24989831) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 6-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 6-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 24989831 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 6-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)CCC(NCCCNc1c3c(nc4cc(Cl)ccc14)CCCC3)C2 |
| InChI | InChI=1S/C25H29ClN4O/c26-17-7-9-20-23(15-17)29-22-5-2-1-4-19(22)25(20)28-13-3-12-27-18-8-10-21-16(14-18)6-11-24(31)30-21/h6-7,9,11,15,18,27H,1-5,8,10,12-14H2,(H,28,29)(H,30,31) |
| InChIKey | BUAMEGRAPHLCJR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|