C30H29N5O4 — CID 24990121
acetic acid;3-[3-(4,7-diazaspiro[2.5]octan-7-yl)isoquinolin-1-yl]-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 24990121) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is acetic acid;3-[3-(4,7-diazaspiro[2.5]octan-7-yl)isoquinolin-1-yl]-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | acetic acid;3-[3-(4,7-diazaspiro[2.5]octan-7-yl)isoquinolin-1-yl]-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 24990121 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | acetic acid;3-[3-(4,7-diazaspiro[2.5]octan-7-yl)isoquinolin-1-yl]-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CC(=O)O.Cc1cccc2c(C3=C(c4nc(N5CCNC6(CC6)C5)cc5ccccc45)C(=O)NC3=O)c[nH]c12 |
| InChI | InChI=1S/C28H25N5O2.C2H4O2/c1-16-5-4-8-19-20(14-29-24(16)19)22-23(27(35)32-26(22)34)25-18-7-3-2-6-17(18)13-21(31-25)33-12-11-30-28(15-33)9-10-28;1-2(3)4/h2-8,13-14,29-30H,9-12,15H2,1H3,(H,32,34,35);1H3,(H,3,4) |
| InChIKey | LAWXOTJYQXKAMI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|