C3HN11O2 — CID 24990287
N-(4,6-diazido-1,3,5-triazin-2-yl)nitramide (PubChem CID 24990287) has the molecular formula C3HN11O2 and a molecular weight of 223.12 g/mol. Its IUPAC name is N-(4,6-diazido-1,3,5-triazin-2-yl)nitramide.
| Compound Name | N-(4,6-diazido-1,3,5-triazin-2-yl)nitramide |
|---|---|
| PubChem CID | 24990287 |
| Molecular Formula | C3HN11O2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | N-(4,6-diazido-1,3,5-triazin-2-yl)nitramide |
| SMILES | [N-]=[N+]=Nc1nc(N=[N+]=[N-])nc(N[N+](=O)[O-])n1 |
| InChI | InChI=1S/C3HN11O2/c4-12-9-1-6-2(10-13-5)8-3(7-1)11-14(15)16/h(H,6,7,8,11) |
| InChIKey | BOSWCLCVUYRMHZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 191.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|