C27H36N4O2S+2 — CID 24991008
4-[6,7-dimethoxy-1-methyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl-trimethylazanium (PubChem CID 24991008) has the molecular formula C27H36N4O2S+2 and a molecular weight of 480.68 g/mol. Its IUPAC name is 4-[6,7-dimethoxy-1-methyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl-trimethylazanium.
| Compound Name | 4-[6,7-dimethoxy-1-methyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl-trimethylazanium |
|---|---|
| PubChem CID | 24991008 |
| Molecular Formula | C27H36N4O2S+2 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-[6,7-dimethoxy-1-methyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-2-yl]butyl-trimethylazanium |
| SMILES | COc1cc2c(/C=C3\Sc4ccccc4N3C)nc(CCCC[N+](C)(C)C)[n+](C)c2cc1OC |
| InChI | InChI=1S/C27H36N4O2S/c1-29-22-18-24(33-7)23(32-6)16-19(22)20(28-26(29)14-10-11-15-31(3,4)5)17-27-30(2)21-12-8-9-13-25(21)34-27/h8-9,12-13,16-18H,10-11,14-15H2,1-7H3/q+2 |
| InChIKey | VPBWAEXXQQOTTD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|