C24H32F6N2O5 — CID 24991074
3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 24991074) has the molecular formula C24H32F6N2O5 and a molecular weight of 542.52 g/mol. Its IUPAC name is 3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24991074 |
| Molecular Formula | C24H32F6N2O5 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 3-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C24H32F6N2O5/c1-6-9-16-14-17(22(23(25,26)27,24(28,29)30)37-15-35-5)10-11-18(16)36-13-8-7-12-32-19(33)21(2,3)31(4)20(32)34/h10-11,14H,6-9,12-13,15H2,1-5H3 |
| InChIKey | RETAMLJKTZACCE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|