C27H30F6N2O4 — CID 24991077
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 24991077) has the molecular formula C27H30F6N2O4 and a molecular weight of 560.54 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24991077 |
| Molecular Formula | C27H30F6N2O4 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C27H30F6N2O4/c1-4-7-18-16-20(25(38,26(28,29)30)27(31,32)33)12-13-21(18)39-15-6-5-14-35-22(36)24(3,34-23(35)37)19-10-8-17(2)9-11-19/h8-13,16,38H,4-7,14-15H2,1-3H3,(H,34,37) |
| InChIKey | NYDAVMSZHKTMQJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|