C29H34F6N2O4 — CID 24991433
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 24991433) has the molecular formula C29H34F6N2O4 and a molecular weight of 588.59 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24991433 |
| Molecular Formula | C29H34F6N2O4 |
| Molecular Weight | 588.59 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc(C(C)C)cc2)C1=O |
| InChI | InChI=1S/C29H34F6N2O4/c1-5-8-20-17-22(27(40,28(30,31)32)29(33,34)35)13-14-23(20)41-16-7-6-15-37-24(38)26(4,36-25(37)39)21-11-9-19(10-12-21)18(2)3/h9-14,17-18,40H,5-8,15-16H2,1-4H3,(H,36,39) |
| InChIKey | CQYKJVUODCCUQT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|