C15H24O4 — CID 24991801
3-[(3R)-3-methylspiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propan-1-ol (PubChem CID 24991801) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 3-[(3R)-3-methylspiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propan-1-ol.
| Compound Name | 3-[(3R)-3-methylspiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 24991801 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-[(3R)-3-methylspiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propan-1-ol |
| SMILES | C[C@]1(CCCO)OOC2(O1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C15H24O4/c1-14(3-2-4-16)17-15(19-18-14)12-6-10-5-11(8-12)9-13(15)7-10/h10-13,16H,2-9H2,1H3/t10?,11?,12?,13?,14-,15?/m1/s1 |
| InChIKey | BTHKVNZPAVGZPV-DUTNFGBUSA-N |
| XLogP | 2.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|