C27H27Cl3N2O3 — CID 24992105
N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3-hydroxy-2,2-dimethylpropanamide (PubChem CID 24992105) has the molecular formula C27H27Cl3N2O3 and a molecular weight of 533.88 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3-hydroxy-2,2-dimethylpropanamide.
| Compound Name | N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3-hydroxy-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 24992105 |
| Molecular Formula | C27H27Cl3N2O3 |
| Molecular Weight | 533.88 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3-hydroxy-2,2-dimethylpropanamide |
| SMILES | CC1(C)CC(NC(=O)C(C)(C)CO)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3Cl)nc2O1 |
| InChI | InChI=1S/C27H27Cl3N2O3/c1-26(2,14-33)25(34)31-22-13-27(3,4)35-24-20(22)12-19(15-5-7-16(28)8-6-15)23(32-24)18-10-9-17(29)11-21(18)30/h5-12,22,33H,13-14H2,1-4H3,(H,31,34) |
| InChIKey | BRSUJFVKAISEFW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.88 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |