About 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one
2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 24992135) has the molecular formula C20H21N3O
and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 24992135 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCCc1nc2ccccn2c(=O)c1-c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C20H21N3O/c1-2-3-6-17-19(15-8-9-16-14(13-15)10-11-21-16)20(24)23-12-5-4-7-18(23)22-17/h4-5,7-9,12-13,21H,2-3,6,10-11H2,1H3 |
| InChIKey | PBJYXCASMFAEIC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one (CID 24992135) is 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one is CCCCc1nc2ccccn2c(=O)c1-c1ccc2c(c1)CCN2.
What is the InChIKey of 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is PBJYXCASMFAEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O/c1-2-3-6-17-19(15-8-9-16-14(13-15)10-11-21-16)20(24)23-12-5-4-7-18(23)22-17/h4-5,7-9,12-13,21H,2-3,6,10-11H2,1H3.
What are the key properties of 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one?
2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 319.41 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 24992135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).