C26H22ClF3N4O5S — CID 24992359
acetic acid;[4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate (PubChem CID 24992359) has the molecular formula C26H22ClF3N4O5S and a molecular weight of 595.00 g/mol. Its IUPAC name is acetic acid;[4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | acetic acid;[4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24992359 |
| Molecular Formula | C26H22ClF3N4O5S |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | acetic acid;[4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)O.NC1=NC(c2ccc(OS(=O)(=O)C(F)(F)F)cc2)(c2cccc(-c3cccc(Cl)c3)c2)C2=NCCN12 |
| InChI | InChI=1S/C24H18ClF3N4O3S.C2H4O2/c25-19-6-2-4-16(14-19)15-3-1-5-18(13-15)23(21-30-11-12-32(21)22(29)31-23)17-7-9-20(10-8-17)35-36(33,34)24(26,27)28;1-2(3)4/h1-10,13-14H,11-12H2,(H2,29,31);1H3,(H,3,4) |
| InChIKey | HKGPLZXCQBKFGA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|