C24H18ClF3N4O3S — CID 24992360
[4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate (PubChem CID 24992360) has the molecular formula C24H18ClF3N4O3S and a molecular weight of 534.95 g/mol. Its IUPAC name is [4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24992360 |
| Molecular Formula | C24H18ClF3N4O3S |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | [4-[5-amino-7-[3-(3-chlorophenyl)phenyl]-2,3-dihydroimidazo[1,2-c]imidazol-7-yl]phenyl] trifluoromethanesulfonate |
| SMILES | NC1=NC(c2ccc(OS(=O)(=O)C(F)(F)F)cc2)(c2cccc(-c3cccc(Cl)c3)c2)C2=NCCN12 |
| InChI | InChI=1S/C24H18ClF3N4O3S/c25-19-6-2-4-16(14-19)15-3-1-5-18(13-15)23(21-30-11-12-32(21)22(29)31-23)17-7-9-20(10-8-17)35-36(33,34)24(26,27)28/h1-10,13-14H,11-12H2,(H2,29,31) |
| InChIKey | GCJSVISARQIUKA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|