C37H44BrClN2O4 — CID 24992818
4-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(2-methoxynaphthalene-1-carbonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide (PubChem CID 24992818) has the molecular formula C37H44BrClN2O4 and a molecular weight of 696.13 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(2-methoxynaphthalene-1-carbonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide.
| Compound Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(2-methoxynaphthalene-1-carbonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
|---|---|
| PubChem CID | 24992818 |
| Molecular Formula | C37H44BrClN2O4 |
| Molecular Weight | 696.13 g/mol |
| Exact Mass | 694.22 |
| IUPAC Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl-(2-methoxynaphthalene-1-carbonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
| SMILES | CC[N+](CC)(CCCCN(Cc1cc2c(cc1Cl)OCO2)C(=O)c1c(OC)ccc2ccccc12)Cc1cc(C)cc(C)c1.[Br-] |
| InChI | InChI=1S/C37H44ClN2O4.BrH/c1-6-40(7-2,24-28-19-26(3)18-27(4)20-28)17-11-10-16-39(23-30-21-34-35(22-32(30)38)44-25-43-34)37(41)36-31-13-9-8-12-29(31)14-15-33(36)42-5;/h8-9,12-15,18-22H,6-7,10-11,16-17,23-25H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | OKLMTIWITDHVLE-UHFFFAOYSA-M |
| XLogP | 5.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.13 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|