C15H22F2N4O2 — CID 24992877
N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide (PubChem CID 24992877) has the molecular formula C15H22F2N4O2 and a molecular weight of 328.36 g/mol. Its IUPAC name is N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide.
| Compound Name | N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide |
|---|---|
| PubChem CID | 24992877 |
| Molecular Formula | C15H22F2N4O2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide |
| SMILES | CN(C#N)C(=O)[C@H](CC(C)(F)F)NC(=O)N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C15H22F2N4O2/c1-14(16,17)9-11(12(22)20(2)10-18)19-13(23)21-7-5-15(3-4-15)6-8-21/h11H,3-9H2,1-2H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | URGLGULODRKSBJ-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|