C8H4F7N3 — CID 24993127
3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazole-4-carbonitrile (PubChem CID 24993127) has the molecular formula C8H4F7N3 and a molecular weight of 275.13 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazole-4-carbonitrile.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 24993127 |
| Molecular Formula | C8H4F7N3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazole-4-carbonitrile |
| SMILES | Cn1cc(C#N)c(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H4F7N3/c1-18-3-4(2-16)5(17-18)6(9,10)7(11,12)8(13,14)15/h3H,1H3 |
| InChIKey | XAUJSOZJBMLOES-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|